![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | The Place_1b-noloop.wav | 2021-04-04 17:51 | 56K | |
![[SND]](/icons/sound2.gif) | GiygasisFatallyWounded1a,48.wav | 2021-04-04 17:51 | 51K | |
![[SND]](/icons/sound2.gif) | InsidetheDungeon1bnoloop.wav | 2021-04-04 17:51 | 50K | |
![[SND]](/icons/sound2.gif) | GiygasDisintegrates1b,48.wav | 2021-04-04 17:51 | 50K | |
![[SND]](/icons/sound2.gif) | Megaton Walk_20-noloop.wav | 2021-04-04 17:51 | 48K | |
![[SND]](/icons/sound2.gif) | Megaton Walk_21-noloop.wav | 2021-04-04 17:51 | 48K | |
![[SND]](/icons/sound2.gif) | Megaton Walk_22-noloop.wav | 2021-04-04 17:51 | 48K | |
![[SND]](/icons/sound2.gif) | GiygasisFatallyWounded24,48.wav | 2021-04-04 17:51 | 47K | |
![[SND]](/icons/sound2.gif) | Megaton Walk_23-noloop.wav | 2021-04-04 17:51 | 47K | |
![[SND]](/icons/sound2.gif) | iygasisFatallyWounded25,112.wav | 2021-04-04 17:51 | 47K | |
![[SND]](/icons/sound2.gif) | InsidetheDungeon24noloop.wav | 2021-04-04 17:51 | 47K | |
![[SND]](/icons/sound2.gif) | iygasisFatallyWounded26,160.wav | 2021-04-04 17:51 | 47K | |
![[SND]](/icons/sound2.gif) | InsidetheDungeon25noloop.wav | 2021-04-04 17:51 | 47K | |
![[SND]](/icons/sound2.gif) | GiygasDisintegrates24,48.wav | 2021-04-04 17:51 | 46K | |
![[SND]](/icons/sound2.gif) | InsidetheDungeon26noloop.wav | 2021-04-04 17:51 | 46K | |
![[SND]](/icons/sound2.gif) | ygasisFatallyWounded27,6496.wav | 2021-04-04 17:51 | 46K | |
![[SND]](/icons/sound2.gif) | GiygasDisintegrates25,112.wav | 2021-04-04 17:51 | 46K | |
![[SND]](/icons/sound2.gif) | GiygasDisintegrates26,160.wav | 2021-04-04 17:51 | 46K | |
![[SND]](/icons/sound2.gif) | InsidetheDungeon28noloop.wav | 2021-04-04 17:51 | 46K | |
![[SND]](/icons/sound2.gif) | ilGiygasAttackspart103,5232.wav | 2021-04-04 17:51 | 46K | |
![[SND]](/icons/sound2.gif) | GiygasDisintegrates28,6496.wav | 2021-04-04 17:51 | 45K | |
![[SND]](/icons/sound2.gif) | TheCliffThatTimeForgot1a.wav | 2021-04-04 17:51 | 44K | |
![[SND]](/icons/sound2.gif) | TheCliffThatTimeForgot24.wav | 2021-04-04 17:51 | 41K | |
![[SND]](/icons/sound2.gif) | TheCliffThatTimeForgot25.wav | 2021-04-04 17:51 | 40K | |
![[SND]](/icons/sound2.gif) | EvilGiygasAttackspart104,48.wav | 2021-04-04 17:51 | 40K | |
![[SND]](/icons/sound2.gif) | TheCliffThatTimeForgot26.wav | 2021-04-04 17:51 | 40K | |
![[SND]](/icons/sound2.gif) | TheCliffThatTimeForgot27.wav | 2021-04-04 17:51 | 39K | |
![[SND]](/icons/sound2.gif) | Choose a File_0d-loop32.wav | 2021-04-04 17:51 | 38K | |
![[SND]](/icons/sound2.gif) | GiygasIntimidation1a,48.wav | 2021-04-04 17:51 | 35K | |
![[SND]](/icons/sound2.gif) | YourName,Please1cloop7824.wav | 2021-04-04 17:51 | 34K | |
![[SND]](/icons/sound2.gif) | ygasisFatallyWounded29,1968.wav | 2021-04-04 17:51 | 33K | |
![[SND]](/icons/sound2.gif) | GiygasisWounded!20loop48.wav | 2021-04-04 17:51 | 33K | |
![[SND]](/icons/sound2.gif) | InsidetheDungeon29noloop.wav | 2021-04-04 17:51 | 33K | |
![[SND]](/icons/sound2.gif) | GiygasisWounded!21loop48.wav | 2021-04-04 17:51 | 33K | |
![[SND]](/icons/sound2.gif) | GiygasDisintegrates29,1968.wav | 2021-04-04 17:51 | 32K | |
![[SND]](/icons/sound2.gif) | GiygasisWounded!22loop48.wav | 2021-04-04 17:51 | 32K | |
![[SND]](/icons/sound2.gif) | GiygasisWounded!23loop48.wav | 2021-04-04 17:51 | 32K | |
![[SND]](/icons/sound2.gif) | BattleAgainstBelch1anoloop.wav | 2021-04-04 17:50 | 32K | |
![[SND]](/icons/sound2.gif) | GiygasisWounded!24loop48.wav | 2021-04-04 17:51 | 32K | |
![[SND]](/icons/sound2.gif) | Moonside Swing_1a-noloop.wav | 2021-04-04 17:51 | 32K | |
![[SND]](/icons/sound2.gif) | GiygasisWounded!25loop112.wav | 2021-04-04 17:51 | 31K | |
![[SND]](/icons/sound2.gif) | Giygas Stirs_1b-noloop.wav | 2021-04-04 17:51 | 31K | |
![[SND]](/icons/sound2.gif) | GiygasisWounded!26loop160.wav | 2021-04-04 17:51 | 31K | |
![[SND]](/icons/sound2.gif) | GiygasIntimidation27,6496.wav | 2021-04-04 17:51 | 31K | |
![[SND]](/icons/sound2.gif) | nctuaryGuardiansChallenge24.wav | 2021-04-04 17:51 | 29K | |
![[SND]](/icons/sound2.gif) | TheCliffThatTimeForgot1c.wav | 2021-04-04 17:51 | 29K | |
![[SND]](/icons/sound2.gif) | Oncoming Foe_29-loop1968.wav | 2021-04-04 17:51 | 28K | |
![[SND]](/icons/sound2.gif) | nctuaryGuardiansChallenge25.wav | 2021-04-04 17:51 | 28K | |
![[SND]](/icons/sound2.gif) | heNightmareBegins...1c,1328.wav | 2021-04-04 17:51 | 28K | |
![[SND]](/icons/sound2.gif) | nctuaryGuardiansChallenge26.wav | 2021-04-04 17:51 | 28K | |
![[SND]](/icons/sound2.gif) | ers,EternalTouristTrap1a,48.wav | 2021-04-04 17:51 | 28K | |
![[SND]](/icons/sound2.gif) | nctuaryGuardiansChallenge27.wav | 2021-04-04 17:51 | 27K | |
![[SND]](/icons/sound2.gif) | You Win!_24-loop48.wav | 2021-04-04 17:51 | 27K | |
![[SND]](/icons/sound2.gif) | Moonside Swing_28-noloop.wav | 2021-04-04 17:51 | 27K | |
![[SND]](/icons/sound2.gif) | You Win!_25-loop112.wav | 2021-04-04 17:51 | 27K | |
![[SND]](/icons/sound2.gif) | You Win!_26-loop160.wav | 2021-04-04 17:51 | 27K | |
![[SND]](/icons/sound2.gif) | TheCliffThatTimeForgot29.wav | 2021-04-04 17:51 | 27K | |
![[SND]](/icons/sound2.gif) | You Win!_27-loop6496.wav | 2021-04-04 17:51 | 26K | |
![[SND]](/icons/sound2.gif) | SmilesandTears00loop7392.wav | 2021-04-04 17:51 | 26K | |
![[SND]](/icons/sound2.gif) | heNightmareBegins...1d,4000.wav | 2021-04-04 17:51 | 26K | |
![[SND]](/icons/sound2.gif) | Boris' Cocktail_1a-loop48.wav | 2021-04-04 17:50 | 25K | |
![[SND]](/icons/sound2.gif) | TheCliffThatTimeForgot1d.wav | 2021-04-04 17:51 | 25K | |
![[SND]](/icons/sound2.gif) | Now, Let's Go!_1c-loop7984.wav | 2021-04-04 17:51 | 24K | |
![[SND]](/icons/sound2.gif) | Ness' Bike_1a-noloop.wav | 2021-04-04 17:51 | 23K | |
![[SND]](/icons/sound2.gif) | OnettBuzzBuzz11aloop64.wav | 2021-04-04 17:51 | 23K | |
![[SND]](/icons/sound2.gif) | MorningintheDesert1bnoloop.wav | 2021-04-04 17:51 | 23K | |
![[SND]](/icons/sound2.gif) | GiygasDisintegrates20,3152.wav | 2021-04-04 17:51 | 23K | |
![[SND]](/icons/sound2.gif) | Giygas' Intro_1c-loop48.wav | 2021-04-04 17:51 | 23K | |
![[SND]](/icons/sound2.gif) | SmilesandTears04loop10192.wav | 2021-04-04 17:51 | 22K | |
![[SND]](/icons/sound2.gif) | Oncoming Boss_1c-loop928.wav | 2021-04-04 17:51 | 22K | |
![[SND]](/icons/sound2.gif) | Boris' Cocktail_24-loop48.wav | 2021-04-04 17:50 | 22K | |
![[SND]](/icons/sound2.gif) | PinkCloudShrine1dloop64.wav | 2021-04-04 17:51 | 22K | |
![[SND]](/icons/sound2.gif) | Boris' Cocktail_25-loop112.wav | 2021-04-04 17:50 | 22K | |
![[SND]](/icons/sound2.gif) | PeacefulRestValley1aloop48.wav | 2021-04-04 17:51 | 22K | |
![[SND]](/icons/sound2.gif) | Boris' Cocktail_26-loop160.wav | 2021-04-04 17:50 | 21K | |
![[SND]](/icons/sound2.gif) | BattleAgainstBelch1cnoloop.wav | 2021-04-04 17:50 | 21K | |
![[SND]](/icons/sound2.gif) | InDalaam,ThereisaWarrior1b.wav | 2021-04-04 17:51 | 21K | |
![[SND]](/icons/sound2.gif) | Boris'Cocktail27loop6496.wav | 2021-04-04 17:50 | 21K | |
![[SND]](/icons/sound2.gif) | You Win!_1c-loop6400.wav | 2021-04-04 17:51 | 21K | |
![[SND]](/icons/sound2.gif) | Oncoming Boss_1d-loop6560.wav | 2021-04-04 17:51 | 20K | |
![[SND]](/icons/sound2.gif) | Ness' Bike_24-noloop.wav | 2021-04-04 17:51 | 20K | |
![[SND]](/icons/sound2.gif) | OnettBuzzBuzz224loop48.wav | 2021-04-04 17:51 | 20K | |
![[SND]](/icons/sound2.gif) | Bazaar_24-noloop.wav | 2021-04-04 17:50 | 20K | |
![[SND]](/icons/sound2.gif) | Ness' Bike_25-noloop.wav | 2021-04-04 17:51 | 20K | |
![[SND]](/icons/sound2.gif) | OnettBuzzBuzz225loop112.wav | 2021-04-04 17:51 | 20K | |
![[SND]](/icons/sound2.gif) | Bazaar_25-noloop.wav | 2021-04-04 17:50 | 20K | |
![[SND]](/icons/sound2.gif) | Giygas Stirs_29-noloop.wav | 2021-04-04 17:51 | 20K | |
![[SND]](/icons/sound2.gif) | Ness' Bike_26-noloop.wav | 2021-04-04 17:51 | 20K | |
![[SND]](/icons/sound2.gif) | OnettBuzzBuzz226loop160.wav | 2021-04-04 17:51 | 20K | |
![[SND]](/icons/sound2.gif) | Bazaar_26-noloop.wav | 2021-04-04 17:50 | 20K | |
![[SND]](/icons/sound2.gif) | GiygasisWounded!1eloop3312.wav | 2021-04-04 17:51 | 19K | |
![[SND]](/icons/sound2.gif) | Ness' Bike_27-noloop.wav | 2021-04-04 17:51 | 19K | |
![[SND]](/icons/sound2.gif) | OnettBuzzBuzz327loop6496.wav | 2021-04-04 17:51 | 19K | |
![[SND]](/icons/sound2.gif) | ayFiveLefttheBuilding20,224.wav | 2021-04-04 17:51 | 19K | |
![[SND]](/icons/sound2.gif) | MorningintheDesert27noloop.wav | 2021-04-04 17:51 | 19K | |
![[SND]](/icons/sound2.gif) | You Win!_20-loop1568.wav | 2021-04-04 17:51 | 19K | |
![[SND]](/icons/sound2.gif) | Belch'sFactory1dloop5744.wav | 2021-04-04 17:50 | 19K | |
![[SND]](/icons/sound2.gif) | Ness' Bike_1c-loop4976.wav | 2021-04-04 17:51 | 18K | |
![[SND]](/icons/sound2.gif) | Belch'sFactory1eloop3104.wav | 2021-04-04 17:50 | 18K | |
![[SND]](/icons/sound2.gif) | Going Down!_24-loop48.wav | 2021-04-04 17:51 | 18K | |
![[SND]](/icons/sound2.gif) | SmilesandTears1cloop1328.wav | 2021-04-04 17:51 | 18K | |
![[SND]](/icons/sound2.gif) | BattleAgainstaMachine20.wav | 2021-04-04 17:50 | 18K | |
![[SND]](/icons/sound2.gif) | s,EternalTouristTrap1d,8224.wav | 2021-04-04 17:51 | 18K | |
![[SND]](/icons/sound2.gif) | InWinters,ThereisaGenius1f.wav | 2021-04-04 17:51 | 18K | |
![[SND]](/icons/sound2.gif) | Going Down!_25-loop112.wav | 2021-04-04 17:51 | 18K | |
![[SND]](/icons/sound2.gif) | TheTendas'Cave20loop3056.wav | 2021-04-04 17:51 | 18K | |
![[SND]](/icons/sound2.gif) | AgainstaWeakOpponent1f,8608.wav | 2021-04-04 17:50 | 18K | |
![[SND]](/icons/sound2.gif) | GiygasisWounded!29loop1968.wav | 2021-04-04 17:51 | 18K | |
![[SND]](/icons/sound2.gif) | s,EternalTouristTrap20,2624.wav | 2021-04-04 17:51 | 18K | |
![[SND]](/icons/sound2.gif) | Going Down!_26-loop160.wav | 2021-04-04 17:51 | 18K | |
![[SND]](/icons/sound2.gif) | BattleAgainstBelch1dnoloop.wav | 2021-04-04 17:50 | 18K | |
![[SND]](/icons/sound2.gif) | Hidden Track_20-loop2624.wav | 2021-04-04 17:51 | 18K | |
![[SND]](/icons/sound2.gif) | OpeningCredits0dloop8384.wav | 2021-04-04 17:51 | 18K | |
![[SND]](/icons/sound2.gif) | Onett Night 1_29-loop1968.wav | 2021-04-04 17:51 | 17K | |
![[SND]](/icons/sound2.gif) | re,HometotheOne&OnlyVenus1b.wav | 2021-04-04 17:51 | 17K | |
![[SND]](/icons/sound2.gif) | TheLostUnderworld1e,6720.wav | 2021-04-04 17:51 | 17K | |
![[SND]](/icons/sound2.gif) | Choose a File_0b-loop5744.wav | 2021-04-04 17:51 | 17K | |
![[SND]](/icons/sound2.gif) | Burp_20-loop2240.wav | 2021-04-04 17:50 | 17K | |
![[SND]](/icons/sound2.gif) | Going Down!_28-loop6496.wav | 2021-04-04 17:51 | 17K | |
![[SND]](/icons/sound2.gif) | MechanicalTinkering1a,5216.wav | 2021-04-04 17:51 | 17K | |
![[SND]](/icons/sound2.gif) | GiygasDisintegrates21,6496.wav | 2021-04-04 17:51 | 17K | |
![[SND]](/icons/sound2.gif) | InDalaam,ThereisaWarrior28.wav | 2021-04-04 17:51 | 17K | |
![[SND]](/icons/sound2.gif) | OnettBuzzBuzz11bloop48.wav | 2021-04-04 17:51 | 17K | |
![[SND]](/icons/sound2.gif) | Hidden Track_29-loop1968.wav | 2021-04-04 17:51 | 16K | |
![[SND]](/icons/sound2.gif) | Now, Let's Go!_15-loop1888.wav | 2021-04-04 17:51 | 16K | |
![[SND]](/icons/sound2.gif) | Get on the Bus_1d-loop7200.wav | 2021-04-04 17:51 | 16K | |
![[SND]](/icons/sound2.gif) | SmilesandTears1dloop1888.wav | 2021-04-04 17:51 | 16K | |
![[SND]](/icons/sound2.gif) | ygasisFatallyWounded1c,1760.wav | 2021-04-04 17:51 | 16K | |
![[SND]](/icons/sound2.gif) | Boy Meets Girl_26-loop160.wav | 2021-04-04 17:50 | 16K | |
![[SND]](/icons/sound2.gif) | unawayFiveLefttheBuilding1e.wav | 2021-04-04 17:51 | 16K | |
![[SND]](/icons/sound2.gif) | PokeyMeansBusiness1d.wav | 2021-04-04 17:51 | 16K | |
![[SND]](/icons/sound2.gif) | InDalaam,ThereisaWarrior1d.wav | 2021-04-04 17:51 | 16K | |
![[SND]](/icons/sound2.gif) | Mysterious Crash_1c-noloop.wav | 2021-04-04 17:51 | 16K | |
![[SND]](/icons/sound2.gif) | OpeningCredits0cloop4656.wav | 2021-04-04 17:51 | 16K | |
![[SND]](/icons/sound2.gif) | onesKnockingattheDoor20,224.wav | 2021-04-04 17:51 | 16K | |
![[SND]](/icons/sound2.gif) | CavernsofWinters20loop7424.wav | 2021-04-04 17:51 | 15K | |
![[SND]](/icons/sound2.gif) | The Tendas' Cave_1c-noloop.wav | 2021-04-04 17:51 | 15K | |
![[SND]](/icons/sound2.gif) | BattleAgainstBelch1enoloop.wav | 2021-04-04 17:50 | 15K | |
![[SND]](/icons/sound2.gif) | TheLostUnderworld1b,7232.wav | 2021-04-04 17:51 | 15K | |
![[SND]](/icons/sound2.gif) | Smiles and Tears_24-loop48.wav | 2021-04-04 17:51 | 15K | |
![[SND]](/icons/sound2.gif) | Smiles and Tears_09-noloop.wav | 2021-04-04 17:51 | 15K | |
![[SND]](/icons/sound2.gif) | Boy Meets Girl_27-loop6496.wav | 2021-04-04 17:50 | 15K | |
![[SND]](/icons/sound2.gif) | Dalaam,ThereisaWarrior1e,48.wav | 2021-04-04 17:51 | 15K | |
![[SND]](/icons/sound2.gif) | SmilesandTears25loop112.wav | 2021-04-04 17:51 | 15K | |
![[SND]](/icons/sound2.gif) | nctuaryGuardiansChallenge29.wav | 2021-04-04 17:51 | 15K | |
![[SND]](/icons/sound2.gif) | InDalaam,ThereisaWarrior20.wav | 2021-04-04 17:51 | 15K | |
![[SND]](/icons/sound2.gif) | TheDeepDarkness1bnoloop.wav | 2021-04-04 17:51 | 15K | |
![[SND]](/icons/sound2.gif) | Moonside Swing_29-noloop.wav | 2021-04-04 17:51 | 15K | |
![[SND]](/icons/sound2.gif) | SmilesandTears26loop160.wav | 2021-04-04 17:51 | 15K | |
![[SND]](/icons/sound2.gif) | re,HometotheOne&OnlyVenus24.wav | 2021-04-04 17:51 | 14K | |
![[SND]](/icons/sound2.gif) | SaturnValleyCaverns1d,5104.wav | 2021-04-04 17:51 | 14K | |
![[SND]](/icons/sound2.gif) | SaturnValleyCaverns1f.wav | 2021-04-04 17:51 | 14K | |
![[SND]](/icons/sound2.gif) | SmilesandTears27loop6496.wav | 2021-04-04 17:51 | 14K | |
![[SND]](/icons/sound2.gif) | re,HometotheOne&OnlyVenus25.wav | 2021-04-04 17:51 | 14K | |
![[SND]](/icons/sound2.gif) | MechanicalTinkering24,48.wav | 2021-04-04 17:51 | 14K | |
![[SND]](/icons/sound2.gif) | TheDeepDarkness1cnoloop.wav | 2021-04-04 17:51 | 14K | |
![[SND]](/icons/sound2.gif) | PokeyMeansBusiness1c.wav | 2021-04-04 17:51 | 14K | |
![[SND]](/icons/sound2.gif) | RunawayFiveontheMove21,4192.wav | 2021-04-04 17:51 | 14K | |
![[SND]](/icons/sound2.gif) | FallingUndergroundba,6880.wav | 2021-04-04 17:51 | 14K | |
![[SND]](/icons/sound2.gif) | re,HometotheOne&OnlyVenus26.wav | 2021-04-04 17:51 | 14K | |
![[SND]](/icons/sound2.gif) | MechanicalTinkering25,112.wav | 2021-04-04 17:51 | 13K | |
![[SND]](/icons/sound2.gif) | You Win!_29-loop1968.wav | 2021-04-04 17:51 | 13K | |
![[SND]](/icons/sound2.gif) | metotheOne&OnlyVenus1d,4000.wav | 2021-04-04 17:51 | 13K | |
![[SND]](/icons/sound2.gif) | cargoExpressatYourService1f.wav | 2021-04-04 17:51 | 13K | |
![[SND]](/icons/sound2.gif) | MechanicalTinkering26,160.wav | 2021-04-04 17:51 | 13K | |
![[SND]](/icons/sound2.gif) | TheLostUnderworld1dnoloop.wav | 2021-04-04 17:51 | 13K | |
![[SND]](/icons/sound2.gif) | SailingtoScaraba1aloop6512.wav | 2021-04-04 17:51 | 13K | |
![[SND]](/icons/sound2.gif) | re,HometotheOne&OnlyVenus27.wav | 2021-04-04 17:51 | 13K | |
![[SND]](/icons/sound2.gif) | PokeyMeansBusiness1a,4208.wav | 2021-04-04 17:51 | 13K | |
![[SND]](/icons/sound2.gif) | Pyramid_1d-noloop.wav | 2021-04-04 17:51 | 13K | |
![[SND]](/icons/sound2.gif) | Onett Theme_24-loop48.wav | 2021-04-04 17:51 | 13K | |
![[SND]](/icons/sound2.gif) | EvilGiygasAttackspart100,48.wav | 2021-04-04 17:51 | 13K | |
![[SND]](/icons/sound2.gif) | KrakenoftheSea29loop1968.wav | 2021-04-04 17:51 | 13K | |
![[SND]](/icons/sound2.gif) | cargoExpressatYourService20.wav | 2021-04-04 17:51 | 13K | |
![[SND]](/icons/sound2.gif) | InsidetheDungeon1cnoloop.wav | 2021-04-04 17:51 | 13K | |
![[SND]](/icons/sound2.gif) | Onett Theme_25-loop112.wav | 2021-04-04 17:51 | 12K | |
![[SND]](/icons/sound2.gif) | Burp_21-loop1920.wav | 2021-04-04 17:50 | 12K | |
![[SND]](/icons/sound2.gif) | heNightmareBegins...1e,2736.wav | 2021-04-04 17:51 | 12K | |
![[SND]](/icons/sound2.gif) | Now, Let's Go!_16-loop2192.wav | 2021-04-04 17:51 | 12K | |
![[SND]](/icons/sound2.gif) | ygasisFatallyWounded1d,1072.wav | 2021-04-04 17:51 | 12K | |
![[SND]](/icons/sound2.gif) | Opening Credits_17-loop32.wav | 2021-04-04 17:51 | 12K | |
![[SND]](/icons/sound2.gif) | ndStoneLumineHallComplete1c.wav | 2021-04-04 17:51 | 12K | |
![[SND]](/icons/sound2.gif) | Flowing Water_20-noloop.wav | 2021-04-04 17:51 | 12K | |
![[SND]](/icons/sound2.gif) | Smiles and Tears_21-noloop.wav | 2021-04-04 17:51 | 12K | |
![[SND]](/icons/sound2.gif) | Onett Theme_26-loop160.wav | 2021-04-04 17:51 | 12K | |
![[SND]](/icons/sound2.gif) | Belch's Factory_1b-noloop.wav | 2021-04-04 17:50 | 12K | |
![[SND]](/icons/sound2.gif) | TheLostUnderworld24loop48.wav | 2021-04-04 17:51 | 12K | |
![[SND]](/icons/sound2.gif) | Ness' Bike_1b-loop64.wav | 2021-04-04 17:51 | 12K | |
![[SND]](/icons/sound2.gif) | TheLostUnderworld25loop112.wav | 2021-04-04 17:51 | 12K | |
![[SND]](/icons/sound2.gif) | Opening Credits_07-noloop.wav | 2021-04-04 17:51 | 12K | |
![[SND]](/icons/sound2.gif) | Opening Credits_18-loop48.wav | 2021-04-04 17:51 | 12K | |
![[SND]](/icons/sound2.gif) | Drilling_20-loop2080.wav | 2021-04-04 17:51 | 12K | |
![[SND]](/icons/sound2.gif) | TheLostUnderworld26loop160.wav | 2021-04-04 17:51 | 11K | |
![[SND]](/icons/sound2.gif) | TheCliffThatTimeForgot1e.wav | 2021-04-04 17:51 | 11K | |
![[SND]](/icons/sound2.gif) | heNightmareBegins...20,2624.wav | 2021-04-04 17:51 | 11K | |
![[SND]](/icons/sound2.gif) | PokeyMeansBusiness20,48.wav | 2021-04-04 17:51 | 11K | |
![[SND]](/icons/sound2.gif) | Onett Theme_1d-loop2688.wav | 2021-04-04 17:51 | 11K | |
![[SND]](/icons/sound2.gif) | InsidetheDungeon20noloop.wav | 2021-04-04 17:51 | 11K | |
![[SND]](/icons/sound2.gif) | PokeyMeansBusiness21,48.wav | 2021-04-04 17:51 | 11K | |
![[SND]](/icons/sound2.gif) | Dr.Andonuts'Lab1eloop5216.wav | 2021-04-04 17:51 | 11K | |
![[SND]](/icons/sound2.gif) | Burp_1f-loop4528.wav | 2021-04-04 17:50 | 10K | |
![[SND]](/icons/sound2.gif) | SailingtoScaraba1fnoloop.wav | 2021-04-04 17:51 | 10K | |
![[SND]](/icons/sound2.gif) | PokeyMeansBusiness22,48.wav | 2021-04-04 17:51 | 10K | |
![[SND]](/icons/sound2.gif) | Mu Training_1a-loop5088.wav | 2021-04-04 17:51 | 10K | |
![[SND]](/icons/sound2.gif) | Now, Let's Go!_10-noloop.wav | 2021-04-04 17:51 | 10K | |
![[SND]](/icons/sound2.gif) | StonehengeBaseShutsDown20.wav | 2021-04-04 17:51 | 10K | |
![[SND]](/icons/sound2.gif) | ygasisFatallyWounded1e,3312.wav | 2021-04-04 17:51 | 10K | |
![[SND]](/icons/sound2.gif) | Ness' Bike_20-loop3056.wav | 2021-04-04 17:51 | 10K | |
![[SND]](/icons/sound2.gif) | DangerousCaves29loop1968.wav | 2021-04-04 17:51 | 10K | |
![[SND]](/icons/sound2.gif) | PhaseDistorterSuccess29.wav | 2021-04-04 17:51 | 10K | |
![[SND]](/icons/sound2.gif) | TheDeepDarkness20loop1568.wav | 2021-04-04 17:51 | 10K | |
![[SND]](/icons/sound2.gif) | PokeyMeansBusiness23,48.wav | 2021-04-04 17:51 | 10K | |
![[SND]](/icons/sound2.gif) | The Tendas' Cave_29-noloop.wav | 2021-04-04 17:51 | 10K | |
![[SND]](/icons/sound2.gif) | TessieHasBeenSighted20.wav | 2021-04-04 17:51 | 9.9K | |
![[SND]](/icons/sound2.gif) | StonehengeBaseShutsDown21.wav | 2021-04-04 17:51 | 9.9K | |
![[SND]](/icons/sound2.gif) | SailingtoScaraba24loop48.wav | 2021-04-04 17:51 | 9.9K | |
![[SND]](/icons/sound2.gif) | cargoExpressatYourService1b.wav | 2021-04-04 17:51 | 9.8K | |
![[SND]](/icons/sound2.gif) | attleAgainstaWeakOpponent1d.wav | 2021-04-04 17:50 | 9.8K | |
![[SND]](/icons/sound2.gif) | PokeyMeansBusiness24,48.wav | 2021-04-04 17:51 | 9.7K | |
![[SND]](/icons/sound2.gif) | Franky_29-loop1968.wav | 2021-04-04 17:51 | 9.7K | |
![[SND]](/icons/sound2.gif) | StonehengeBaseShutsDown22.wav | 2021-04-04 17:51 | 9.6K | |
![[SND]](/icons/sound2.gif) | Burp_1c-noloop.wav | 2021-04-04 17:50 | 9.6K | |
![[SND]](/icons/sound2.gif) | heCliffThatTimeForgot1f,128.wav | 2021-04-04 17:51 | 9.6K | |
![[SND]](/icons/sound2.gif) | SailingtoScaraba25loop112.wav | 2021-04-04 17:51 | 9.5K | |
![[SND]](/icons/sound2.gif) | ndStoneLilliputSteps1b,3968.wav | 2021-04-04 17:51 | 9.5K | |
![[SND]](/icons/sound2.gif) | Smiles and Tears_0c-noloop.wav | 2021-04-04 17:51 | 9.5K | |
![[SND]](/icons/sound2.gif) | InDalaam,ThereisaWarrior21.wav | 2021-04-04 17:51 | 9.4K | |
![[SND]](/icons/sound2.gif) | s,EternalTouristTrap1f,4544.wav | 2021-04-04 17:51 | 9.4K | |
![[SND]](/icons/sound2.gif) | PokeyMeansBusiness25,112.wav | 2021-04-04 17:51 | 9.4K | |
![[SND]](/icons/sound2.gif) | OpeningCredits29loop1968.wav | 2021-04-04 17:51 | 9.4K | |
![[SND]](/icons/sound2.gif) | cargoExpressatYourService22.wav | 2021-04-04 17:51 | 9.4K | |
![[SND]](/icons/sound2.gif) | PokeyMeansBusiness29.wav | 2021-04-04 17:51 | 9.4K | |
![[SND]](/icons/sound2.gif) | Opening Credits_19-loop32.wav | 2021-04-04 17:51 | 9.4K | |
![[SND]](/icons/sound2.gif) | StonehengeBaseShutsDown23.wav | 2021-04-04 17:51 | 9.3K | |
![[SND]](/icons/sound2.gif) | SailingtoScaraba26loop160.wav | 2021-04-04 17:51 | 9.2K | |
![[SND]](/icons/sound2.gif) | Get on the Bus_29-loop1968.wav | 2021-04-04 17:51 | 9.2K | |
![[SND]](/icons/sound2.gif) | PokeyMeansBusiness26,160.wav | 2021-04-04 17:51 | 9.1K | |
![[SND]](/icons/sound2.gif) | attleAgainstaWeakOpponent1c.wav | 2021-04-04 17:50 | 9.1K | |
![[SND]](/icons/sound2.gif) | Opening Credits_1a-loop64.wav | 2021-04-04 17:51 | 9.0K | |
![[SND]](/icons/sound2.gif) | Hi Hi Hi_23-loop48.wav | 2021-04-04 17:51 | 9.0K | |
![[SND]](/icons/sound2.gif) | Hidden Track_24-noloop.wav | 2021-04-04 17:51 | 9.0K | |
![[SND]](/icons/sound2.gif) | BattleAgainstaMachine1c,48.wav | 2021-04-04 17:50 | 9.0K | |
![[SND]](/icons/sound2.gif) | Opening Credits_10-noloop.wav | 2021-04-04 17:51 | 8.9K | |
![[SND]](/icons/sound2.gif) | Giygas' Static_1c-loop96.wav | 2021-04-04 17:51 | 8.7K | |
![[SND]](/icons/sound2.gif) | Hidden Track_25-noloop.wav | 2021-04-04 17:51 | 8.7K | |
![[SND]](/icons/sound2.gif) | nctuaryGuardiansChallenge1c.wav | 2021-04-04 17:51 | 8.5K | |
![[SND]](/icons/sound2.gif) | alaam,ThereisaWarrior22,736.wav | 2021-04-04 17:51 | 8.5K | |
![[SND]](/icons/sound2.gif) | Burp_22-loop1504.wav | 2021-04-04 17:50 | 8.5K | |
![[SND]](/icons/sound2.gif) | DeadEndChaosTheatre1b.wav | 2021-04-04 17:51 | 8.5K | |
![[SND]](/icons/sound2.gif) | Hidden Track_26-noloop.wav | 2021-04-04 17:51 | 8.4K | |
![[SND]](/icons/sound2.gif) | Lava Springs_20-loop3056.wav | 2021-04-04 17:51 | 8.1K | |
![[SND]](/icons/sound2.gif) | Giygas Stirs_20-loop1568.wav | 2021-04-04 17:51 | 8.1K | |
![[SND]](/icons/sound2.gif) | You Win!_1d-loop2752.wav | 2021-04-04 17:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | Now, Let's Go!_17-loop32.wav | 2021-04-04 17:51 | 8.0K | |
![[SND]](/icons/sound2.gif) | Boris'Cocktail29loop1968.wav | 2021-04-04 17:50 | 8.0K | |
![[SND]](/icons/sound2.gif) | Ness' Bike_1e-noloop.wav | 2021-04-04 17:51 | 7.9K | |
![[SND]](/icons/sound2.gif) | ygasisFatallyWounded20,1568.wav | 2021-04-04 17:51 | 7.8K | |
![[SND]](/icons/sound2.gif) | SaturnValleyCaverns1e,3376.wav | 2021-04-04 17:51 | 7.8K | |
![[SND]](/icons/sound2.gif) | TheHeroesReturnpart11b,3376.wav | 2021-04-04 17:51 | 7.8K | |
![[SND]](/icons/sound2.gif) | Lava Springs_27-noloop.wav | 2021-04-04 17:51 | 7.8K | |
![[SND]](/icons/sound2.gif) | TheHeroesReturnpart126,160.wav | 2021-04-04 17:51 | 7.6K | |
![[SND]](/icons/sound2.gif) | TheHeroesReturnpart129,1968.wav | 2021-04-04 17:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | TheDeepDarkness1anoloop.wav | 2021-04-04 17:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | DeadEndChaosTheatre24.wav | 2021-04-04 17:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | Get on the Bus_24-loop3408.wav | 2021-04-04 17:51 | 7.5K | |
![[SND]](/icons/sound2.gif) | Now, Let's Go!_18-loop48.wav | 2021-04-04 17:51 | 7.4K | |
![[SND]](/icons/sound2.gif) | YourName,PleaseNoiseless0c.wav | 2021-04-04 17:51 | 7.3K | |
![[SND]](/icons/sound2.gif) | Belch'sFactory20loop2240.wav | 2021-04-04 17:50 | 7.2K | |
![[SND]](/icons/sound2.gif) | DeadEndChaosTheatre25.wav | 2021-04-04 17:51 | 7.2K | |
![[SND]](/icons/sound2.gif) | ExpressatYourService23,3424.wav | 2021-04-04 17:51 | 7.2K | |
![[SND]](/icons/sound2.gif) | attleAgainstaWeakOpponent1e.wav | 2021-04-04 17:50 | 7.2K | |
![[SND]](/icons/sound2.gif) | Dr.Andonuts'Lab1fnoloop.wav | 2021-04-04 17:51 | 7.1K | |
![[SND]](/icons/sound2.gif) | Now, Let's Go!_0e-noloop.wav | 2021-04-04 17:51 | 7.0K | |
![[SND]](/icons/sound2.gif) | UnusedPokeyJingle1aloop80.wav | 2021-04-04 17:51 | 7.0K | |
![[SND]](/icons/sound2.gif) | Drilling_21-loop96.wav | 2021-04-04 17:51 | 7.0K | |
![[SND]](/icons/sound2.gif) | TheMetropolisofFourside1a.wav | 2021-04-04 17:51 | 6.9K | |
![[SND]](/icons/sound2.gif) | Flowing Water_21-noloop.wav | 2021-04-04 17:51 | 6.9K | |
![[SND]](/icons/sound2.gif) | DeadEndChaosTheatre26.wav | 2021-04-04 17:51 | 6.9K | |
![[SND]](/icons/sound2.gif) | heNightmareBegins...1f,1248.wav | 2021-04-04 17:51 | 6.8K | |
![[SND]](/icons/sound2.gif) | nctuaryGuardiansChallenge1d.wav | 2021-04-04 17:51 | 6.7K | |
![[SND]](/icons/sound2.gif) | MetropolisofFourside1d,3248.wav | 2021-04-04 17:51 | 6.5K | |
![[SND]](/icons/sound2.gif) | Get on the Bus_20-loop3056.wav | 2021-04-04 17:51 | 6.5K | |
![[SND]](/icons/sound2.gif) | PhaseDistorterFailed1a.wav | 2021-04-04 17:51 | 6.5K | |
![[SND]](/icons/sound2.gif) | Giygas' Static_20-loop1568.wav | 2021-04-04 17:51 | 6.5K | |
![[SND]](/icons/sound2.gif) | Ness' Bike_29-noloop.wav | 2021-04-04 17:51 | 6.4K | |
![[SND]](/icons/sound2.gif) | oundStoneLilliputSteps24,48.wav | 2021-04-04 17:51 | 6.4K | |
![[SND]](/icons/sound2.gif) | OnettBuzzBuzz229loop1968.wav | 2021-04-04 17:51 | 6.4K | |
![[SND]](/icons/sound2.gif) | illiputStepsComplete20,3152.wav | 2021-04-04 17:51 | 6.4K | |
![[SND]](/icons/sound2.gif) | TheMetropolisofFourside1e.wav | 2021-04-04 17:51 | 6.3K | |
![[SND]](/icons/sound2.gif) | DeadEndChaosTheatre28.wav | 2021-04-04 17:51 | 6.3K | |
![[SND]](/icons/sound2.gif) | Bazaar_29-noloop.wav | 2021-04-04 17:50 | 6.3K | |
![[SND]](/icons/sound2.gif) | SailingtoScaraba21noloop.wav | 2021-04-04 17:51 | 6.1K | |
![[SND]](/icons/sound2.gif) | undStoneLilliputSteps25,112.wav | 2021-04-04 17:51 | 6.1K | |
![[SND]](/icons/sound2.gif) | PokeyMeansBusiness1e.wav | 2021-04-04 17:51 | 6.0K | |
![[SND]](/icons/sound2.gif) | attleAgainstaWeakOpponent24.wav | 2021-04-04 17:50 | 5.9K | |
![[SND]](/icons/sound2.gif) | Opening Credits_24-loop48.wav | 2021-04-04 17:51 | 5.9K | |
![[SND]](/icons/sound2.gif) | Whoa!_20-loop2624.wav | 2021-04-04 17:51 | 5.9K | |
![[SND]](/icons/sound2.gif) | Title Screen_0b-noloop.wav | 2021-04-04 17:51 | 5.9K | |
![[SND]](/icons/sound2.gif) | PhaseDistorterFailed29,1968.wav | 2021-04-04 17:51 | 5.9K | |
![[SND]](/icons/sound2.gif) | undStoneLilliputSteps26,160.wav | 2021-04-04 17:51 | 5.8K | |
![[SND]](/icons/sound2.gif) | Super Dry Dance_1d-loop32.wav | 2021-04-04 17:51 | 5.8K | |
![[SND]](/icons/sound2.gif) | YourName,PleaseNoiseless0d.wav | 2021-04-04 17:51 | 5.8K | |
![[SND]](/icons/sound2.gif) | Hi Hi Hi_22-loop1504.wav | 2021-04-04 17:51 | 5.7K | |
![[SND]](/icons/sound2.gif) | metotheOne&OnlyVenus1e,2736.wav | 2021-04-04 17:51 | 5.7K | |
![[SND]](/icons/sound2.gif) | attleAgainstaWeakOpponent25.wav | 2021-04-04 17:50 | 5.6K | |
![[SND]](/icons/sound2.gif) | Giygas' Intro_1a-noloop.wav | 2021-04-04 17:51 | 5.6K | |
![[SND]](/icons/sound2.gif) | Opening Credits_25-loop112.wav | 2021-04-04 17:51 | 5.6K | |
![[SND]](/icons/sound2.gif) | Franky_24-loop48.wav | 2021-04-04 17:51 | 5.6K | |
![[SND]](/icons/sound2.gif) | Get on the Bus_1c-noloop.wav | 2021-04-04 17:51 | 5.5K | |
![[SND]](/icons/sound2.gif) | TheTendas'Cave1bloop1136.wav | 2021-04-04 17:51 | 5.5K | |
![[SND]](/icons/sound2.gif) | DeadEndChaosTheatre20,2624.wav | 2021-04-04 17:51 | 5.4K | |
![[SND]](/icons/sound2.gif) | cargoExpressatYourService28.wav | 2021-04-04 17:51 | 5.4K | |
![[SND]](/icons/sound2.gif) | YourName,PleaseNoiseless0e.wav | 2021-04-04 17:51 | 5.4K | |
![[SND]](/icons/sound2.gif) | InsidetheDungeon1dnoloop.wav | 2021-04-04 17:51 | 5.4K | |
![[SND]](/icons/sound2.gif) | toneLilliputStepsComplete22.wav | 2021-04-04 17:51 | 5.4K | |
![[SND]](/icons/sound2.gif) | attleAgainstaWeakOpponent26.wav | 2021-04-04 17:50 | 5.3K | |
![[SND]](/icons/sound2.gif) | Opening Credits_26-loop160.wav | 2021-04-04 17:51 | 5.3K | |
![[SND]](/icons/sound2.gif) | Franky_25-loop112.wav | 2021-04-04 17:51 | 5.3K | |
![[SND]](/icons/sound2.gif) | BecauseILoveYou1cnoloop.wav | 2021-04-04 17:50 | 5.2K | |
![[SND]](/icons/sound2.gif) | TheDeepDarkness29noloop.wav | 2021-04-04 17:51 | 5.2K | |
![[SND]](/icons/sound2.gif) | Now, Let's Go!_19-loop32.wav | 2021-04-04 17:51 | 5.1K | |
![[SND]](/icons/sound2.gif) | PokeyMeansBusiness1f,2192.wav | 2021-04-04 17:51 | 5.1K | |
![[SND]](/icons/sound2.gif) | YourName,PleaseNoiseless0f.wav | 2021-04-04 17:51 | 5.1K | |
![[SND]](/icons/sound2.gif) | Franky_26-loop160.wav | 2021-04-04 17:51 | 5.0K | |
![[SND]](/icons/sound2.gif) | SaturnValleyCaverns20,2240.wav | 2021-04-04 17:51 | 4.9K | |
![[SND]](/icons/sound2.gif) | Get on the Bus_1a-noloop.wav | 2021-04-04 17:51 | 4.9K | |
![[SND]](/icons/sound2.gif) | RunawayFiveontheMove29.wav | 2021-04-04 17:51 | 4.9K | |
![[SND]](/icons/sound2.gif) | Now, Let's Go!_1a-loop48.wav | 2021-04-04 17:51 | 4.8K | |
![[SND]](/icons/sound2.gif) | YourName,PleaseNoiseless10.wav | 2021-04-04 17:51 | 4.8K | |
![[SND]](/icons/sound2.gif) | Now, Let's Go!_11-noloop.wav | 2021-04-04 17:51 | 4.8K | |
![[SND]](/icons/sound2.gif) | BattleAgainstBelch1fnoloop.wav | 2021-04-04 17:50 | 4.8K | |
![[SND]](/icons/sound2.gif) | eCliffThatTimeForgot20,2080.wav | 2021-04-04 17:51 | 4.7K | |
![[SND]](/icons/sound2.gif) | attleAgainstaWeakOpponent27.wav | 2021-04-04 17:50 | 4.7K | |
![[SND]](/icons/sound2.gif) | Opening Credits_15-noloop.wav | 2021-04-04 17:51 | 4.7K | |
![[SND]](/icons/sound2.gif) | SoundStone~LilliputSteps29.wav | 2021-04-04 17:51 | 4.6K | |
![[SND]](/icons/sound2.gif) | MysteriousCrash29loop1968.wav | 2021-04-04 17:51 | 4.5K | |
![[SND]](/icons/sound2.gif) | cargoExpressatYourService1e.wav | 2021-04-04 17:51 | 4.4K | |
![[SND]](/icons/sound2.gif) | WhataGreatPicture!20noloop.wav | 2021-04-04 17:51 | 4.4K | |
![[SND]](/icons/sound2.gif) | TheDeepDarkness24noloop.wav | 2021-04-04 17:51 | 4.4K | |
![[SND]](/icons/sound2.gif) | OnettBuzzBuzz11cnoloop.wav | 2021-04-04 17:51 | 4.4K | |
![[SND]](/icons/sound2.gif) | Megaton Walk_16-noloop.wav | 2021-04-04 17:51 | 4.3K | |
![[SND]](/icons/sound2.gif) | TheLostUnderworld1c,1488.wav | 2021-04-04 17:51 | 4.3K | |
![[SND]](/icons/sound2.gif) | attleAgainstaMachine1b,1568.wav | 2021-04-04 17:50 | 4.1K | |
![[SND]](/icons/sound2.gif) | Moonside Swing_03-loop2000.wav | 2021-04-04 17:51 | 4.1K | |
![[SND]](/icons/sound2.gif) | TheDeepDarkness25noloop.wav | 2021-04-04 17:51 | 4.1K | |
![[SND]](/icons/sound2.gif) | InDalaam,ThereisaWarrior29.wav | 2021-04-04 17:51 | 4.1K | |
![[SND]](/icons/sound2.gif) | SaturnValleyCaverns21,1920.wav | 2021-04-04 17:51 | 4.0K | |
![[SND]](/icons/sound2.gif) | Boris'Cocktail1eloop1856.wav | 2021-04-04 17:50 | 4.0K | |
![[SND]](/icons/sound2.gif) | Sunrise&OnettTheme1fnoloop.wav | 2021-04-04 17:51 | 3.9K | |
![[SND]](/icons/sound2.gif) | SailingtoScaraba1enoloop.wav | 2021-04-04 17:51 | 3.9K | |
![[SND]](/icons/sound2.gif) | Onett Night 2_1d-noloop.wav | 2021-04-04 17:51 | 3.9K | |
![[SND]](/icons/sound2.gif) | UnusedPokeyJingle24loop48.wav | 2021-04-04 17:51 | 3.9K | |
![[SND]](/icons/sound2.gif) | Boris' Cocktail_1d-noloop.wav | 2021-04-04 17:50 | 3.9K | |
![[SND]](/icons/sound2.gif) | Boris' Cocktail_1f-loop448.wav | 2021-04-04 17:50 | 3.8K | |
![[SND]](/icons/sound2.gif) | TheDeepDarkness26noloop.wav | 2021-04-04 17:51 | 3.8K | |
![[SND]](/icons/sound2.gif) | Giygas' Lair_20-noloop.wav | 2021-04-04 17:51 | 3.8K | |
![[SND]](/icons/sound2.gif) | unawayFiveLefttheBuilding1d.wav | 2021-04-04 17:51 | 3.7K | |
![[SND]](/icons/sound2.gif) | TheHeroesReturnpart11a.wav | 2021-04-04 17:51 | 3.7K | |
![[SND]](/icons/sound2.gif) | Boy Meets Girl_1b-loop1536.wav | 2021-04-04 17:50 | 3.6K | |
![[SND]](/icons/sound2.gif) | PhaseDistorterSuccess24.wav | 2021-04-04 17:51 | 3.6K | |
![[SND]](/icons/sound2.gif) | PinkCloudShrine1bloop1680.wav | 2021-04-04 17:51 | 3.6K | |
![[SND]](/icons/sound2.gif) | UnusedPokeyJingle25loop112.wav | 2021-04-04 17:51 | 3.5K | |
![[SND]](/icons/sound2.gif) | Boy Meets Girl_1d-noloop.wav | 2021-04-04 17:50 | 3.5K | |
![[SND]](/icons/sound2.gif) | s,EternalTouristTrap1b,1648.wav | 2021-04-04 17:51 | 3.5K | |
![[SND]](/icons/sound2.gif) | Smiles and Tears_11-noloop.wav | 2021-04-04 17:51 | 3.5K | |
![[SND]](/icons/sound2.gif) | Enjoy Your Stay_1c-noloop.wav | 2021-04-04 17:51 | 3.5K | |
![[SND]](/icons/sound2.gif) | Giygas' Lair_21-noloop.wav | 2021-04-04 17:51 | 3.4K | |
![[SND]](/icons/sound2.gif) | MorningintheDesert20,1568.wav | 2021-04-04 17:51 | 3.4K | |
![[SND]](/icons/sound2.gif) | Get on the Bus_1e-loop1456.wav | 2021-04-04 17:51 | 3.4K | |
![[SND]](/icons/sound2.gif) | PhaseDistorterFailed24.wav | 2021-04-04 17:51 | 3.4K | |
![[SND]](/icons/sound2.gif) | PhaseDistorterSuccess25.wav | 2021-04-04 17:51 | 3.3K | |
![[SND]](/icons/sound2.gif) | UnusedPokeyJingle26loop160.wav | 2021-04-04 17:51 | 3.2K | |
![[SND]](/icons/sound2.gif) | Ness' Bike_1d-loop976.wav | 2021-04-04 17:51 | 3.2K | |
![[SND]](/icons/sound2.gif) | GoodFriends,BadFriends24.wav | 2021-04-04 17:51 | 3.2K | |
![[SND]](/icons/sound2.gif) | TheDeepDarkness27noloop.wav | 2021-04-04 17:51 | 3.2K | |
![[SND]](/icons/sound2.gif) | Opening Credits_1b-loop48.wav | 2021-04-04 17:51 | 3.1K | |
![[SND]](/icons/sound2.gif) | Giygas' Lair_22-noloop.wav | 2021-04-04 17:51 | 3.1K | |
![[SND]](/icons/sound2.gif) | SailingtoScaraba22loop736.wav | 2021-04-04 17:51 | 3.1K | |
![[SND]](/icons/sound2.gif) | PhaseDistorterFailed25.wav | 2021-04-04 17:51 | 3.0K | |
![[SND]](/icons/sound2.gif) | cargoExpressatYourService29.wav | 2021-04-04 17:51 | 3.0K | |
![[SND]](/icons/sound2.gif) | BecauseILoveYou29noloop.wav | 2021-04-04 17:50 | 3.0K | |
![[SND]](/icons/sound2.gif) | PhaseDistorterSuccess26.wav | 2021-04-04 17:51 | 3.0K | |
![[SND]](/icons/sound2.gif) | Mysterious Crash_20-noloop.wav | 2021-04-04 17:51 | 3.0K | |
![[SND]](/icons/sound2.gif) | Secret Passage_1a-loop736.wav | 2021-04-04 17:51 | 2.9K | |
![[SND]](/icons/sound2.gif) | GoodFriends,BadFriends25.wav | 2021-04-04 17:51 | 2.9K | |
![[SND]](/icons/sound2.gif) | Burp_23-loop48.wav | 2021-04-04 17:50 | 2.9K | |
![[SND]](/icons/sound2.gif) | SmilesandTears05loop1296.wav | 2021-04-04 17:51 | 2.8K | |
![[SND]](/icons/sound2.gif) | Giygas' Lair_23-noloop.wav | 2021-04-04 17:51 | 2.8K | |
![[SND]](/icons/sound2.gif) | PhaseDistorterFailed26.wav | 2021-04-04 17:51 | 2.7K | |
![[SND]](/icons/sound2.gif) | Choose a File_0c-noloop.wav | 2021-04-04 17:51 | 2.7K | |
![[SND]](/icons/sound2.gif) | unawayFiveLefttheBuilding1a.wav | 2021-04-04 17:51 | 2.6K | |
![[SND]](/icons/sound2.gif) | GoodFriends,BadFriends26.wav | 2021-04-04 17:51 | 2.6K | |
![[SND]](/icons/sound2.gif) | TheMetropolisofFourside28.wav | 2021-04-04 17:51 | 2.5K | |
![[SND]](/icons/sound2.gif) | OpeningCredits0floop1072.wav | 2021-04-04 17:51 | 2.5K | |
![[SND]](/icons/sound2.gif) | Giygas Stirs_24-noloop.wav | 2021-04-04 17:51 | 2.5K | |
![[SND]](/icons/sound2.gif) | nters,ThereisaGenius1a,1184.wav | 2021-04-04 17:51 | 2.5K | |
![[SND]](/icons/sound2.gif) | re,HometotheOne&OnlyVenus1f.wav | 2021-04-04 17:51 | 2.5K | |
![[SND]](/icons/sound2.gif) | Opening Credits_1c-noloop.wav | 2021-04-04 17:51 | 2.5K | |
![[SND]](/icons/sound2.gif) | MechanicalTinkering10.wav | 2021-04-04 17:51 | 2.5K | |
![[SND]](/icons/sound2.gif) | DeadEndChaosTheatre1d.wav | 2021-04-04 17:51 | 2.5K | |
![[SND]](/icons/sound2.gif) | Sunrise&OnettTheme1e,1152.wav | 2021-04-04 17:51 | 2.5K | |
![[SND]](/icons/sound2.gif) | Onett Night 2_1c-noloop.wav | 2021-04-04 17:51 | 2.4K | |
![[SND]](/icons/sound2.gif) | Heartless Hotel_22-loop736.wav | 2021-04-04 17:51 | 2.4K | |
![[SND]](/icons/sound2.gif) | Pokey_18-loop48.wav | 2021-04-04 17:51 | 2.4K | |
![[SND]](/icons/sound2.gif) | YourName,PleaseNoiseless11.wav | 2021-04-04 17:51 | 2.4K | |
![[SND]](/icons/sound2.gif) | PhaseDistorterSuccess27.wav | 2021-04-04 17:51 | 2.4K | |
![[SND]](/icons/sound2.gif) | Dr.Andonuts'Lab1anoloop.wav | 2021-04-04 17:51 | 2.2K | |
![[SND]](/icons/sound2.gif) | Giygas Stirs_25-noloop.wav | 2021-04-04 17:51 | 2.2K | |
![[SND]](/icons/sound2.gif) | OnettBuzzBuzz11dnoloop.wav | 2021-04-04 17:51 | 2.1K | |
![[SND]](/icons/sound2.gif) | PhaseDistorterFailed27.wav | 2021-04-04 17:51 | 2.1K | |
![[SND]](/icons/sound2.gif) | Opening Credits_20-loop224.wav | 2021-04-04 17:51 | 2.0K | |
![[SND]](/icons/sound2.gif) | Otherworldly Foe_28-noloop.wav | 2021-04-04 17:51 | 1.9K | |
![[SND]](/icons/sound2.gif) | Giygas Stirs_26-noloop.wav | 2021-04-04 17:51 | 1.9K | |
![[SND]](/icons/sound2.gif) | Pyramid_1c-noloop.wav | 2021-04-04 17:51 | 1.9K | |
![[SND]](/icons/sound2.gif) | cargoExpressatYourService21.wav | 2021-04-04 17:51 | 1.8K | |
![[SND]](/icons/sound2.gif) | Venus Live!_21-noloop.wav | 2021-04-04 17:51 | 1.8K | |
![[SND]](/icons/sound2.gif) | attleAgainstaWeakOpponent29.wav | 2021-04-04 17:50 | 1.8K | |
![[SND]](/icons/sound2.gif) | AGoodNight'sRest20noloop.wav | 2021-04-04 17:50 | 1.8K | |
![[SND]](/icons/sound2.gif) | Onett Night 2_24-loop48.wav | 2021-04-04 17:51 | 1.7K | |
![[SND]](/icons/sound2.gif) | Oncoming Foe_1f-noloop.wav | 2021-04-04 17:51 | 1.7K | |
![[SND]](/icons/sound2.gif) | MechanicalTinkering0c,48.wav | 2021-04-04 17:51 | 1.6K | |
![[SND]](/icons/sound2.gif) | Moonside Swing_14-noloop.wav | 2021-04-04 17:51 | 1.6K | |
![[SND]](/icons/sound2.gif) | MechanicalTinkering11,48.wav | 2021-04-04 17:51 | 1.5K | |
![[SND]](/icons/sound2.gif) | Megaton Walk_0b-loop32.wav | 2021-04-04 17:51 | 1.4K | |
![[SND]](/icons/sound2.gif) | Onett Night 2_25-loop112.wav | 2021-04-04 17:51 | 1.4K | |
![[SND]](/icons/sound2.gif) | Megaton Walk_05-loop560.wav | 2021-04-04 17:51 | 1.4K | |
![[SND]](/icons/sound2.gif) | Giygas' Intro_27-noloop.wav | 2021-04-04 17:51 | 1.3K | |
![[SND]](/icons/sound2.gif) | BattleAgainstaMachine1d,416.wav | 2021-04-04 17:50 | 1.1K | |
![[SND]](/icons/sound2.gif) | Onett Night 2_26-loop160.wav | 2021-04-04 17:51 | 1.1K | |
![[SND]](/icons/sound2.gif) | SailingtoScaraba20noloop.wav | 2021-04-04 17:51 | 1.1K | |
![[SND]](/icons/sound2.gif) | Pyramid_1f-loop400.wav | 2021-04-04 17:51 | 1.0K | |
![[SND]](/icons/sound2.gif) | YourName,Please1bnoloop.wav | 2021-04-04 17:51 | 1.0K | |
![[SND]](/icons/sound2.gif) | eAgainstaWeirdOpponent24,48.wav | 2021-04-04 17:50 | 1.0K | |
![[SND]](/icons/sound2.gif) | Opening Credits_16-noloop.wav | 2021-04-04 17:51 | 1.0K | |
![[SND]](/icons/sound2.gif) | YourName,PleaseNoiseless12.wav | 2021-04-04 17:51 | 972 | |
![[SND]](/icons/sound2.gif) | Opening Credits_21-noloop.wav | 2021-04-04 17:51 | 940 | |
![[SND]](/icons/sound2.gif) | Onett Night 1_22-noloop.wav | 2021-04-04 17:51 | 940 | |
![[SND]](/icons/sound2.gif) | YourName,PleaseNoiseless13.wav | 2021-04-04 17:51 | 876 | |
![[SND]](/icons/sound2.gif) | Megaton Walk_13-noloop.wav | 2021-04-04 17:51 | 876 | |
![[SND]](/icons/sound2.gif) | Onett Night 2_20-noloop.wav | 2021-04-04 17:51 | 780 | |
![[SND]](/icons/sound2.gif) | Mu Training_17-loop32.wav | 2021-04-04 17:51 | 720 | |
![[SND]](/icons/sound2.gif) | AgainstaWeirdOpponent25,112.wav | 2021-04-04 17:50 | 688 | |
![[SND]](/icons/sound2.gif) | SmilesandTears07loop224.wav | 2021-04-04 17:51 | 624 | |
![[SND]](/icons/sound2.gif) | TheHeroesReturnpart124.wav | 2021-04-04 17:51 | 556 | |
![[SND]](/icons/sound2.gif) | Get on the Bus_28-noloop.wav | 2021-04-04 17:51 | 556 | |
![[SND]](/icons/sound2.gif) | Boy Meets Girl_24-loop48.wav | 2021-04-04 17:50 | 496 | |
![[SND]](/icons/sound2.gif) | MechanicalTinkering19,32.wav | 2021-04-04 17:51 | 432 | |
![[SND]](/icons/sound2.gif) | KrakenoftheSea25loop112.wav | 2021-04-04 17:51 | 432 | |
![[SND]](/icons/sound2.gif) | KrakenoftheSea24loop48.wav | 2021-04-04 17:51 | 432 | |
![[SND]](/icons/sound2.gif) | KrakenoftheSea23loop48.wav | 2021-04-04 17:51 | 432 | |
![[SND]](/icons/sound2.gif) | KrakenoftheSea22loop48.wav | 2021-04-04 17:51 | 432 | |
![[SND]](/icons/sound2.gif) | KrakenoftheSea1dloop48.wav | 2021-04-04 17:51 | 432 | |
![[SND]](/icons/sound2.gif) | KrakenoftheSea1cloop48.wav | 2021-04-04 17:51 | 432 | |
![[SND]](/icons/sound2.gif) | KrakenoftheSea1bloop48.wav | 2021-04-04 17:51 | 432 | |
![[SND]](/icons/sound2.gif) | KrakenoftheSea1aloop48.wav | 2021-04-04 17:51 | 432 | |
![[SND]](/icons/sound2.gif) | Super Dry Dance_1c-loop48.wav | 2021-04-04 17:51 | 368 | |
![[SND]](/icons/sound2.gif) | SoundStone~RainyCircle12,32.wav | 2021-04-04 17:51 | 208 | |
|